C16H9N5O — CID 650321
8-phenyl-4-oxa-3,5,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,5,7,10,12,14-heptaene (PubChem CID 650321) has the molecular formula C16H9N5O and a molecular weight of 287.28 g/mol. Its IUPAC name is 8-phenyl-4-oxa-3,5,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,5,7,10,12,14-heptaene.
| Compound Name | 8-phenyl-4-oxa-3,5,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 650321 |
| Molecular Formula | C16H9N5O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 8-phenyl-4-oxa-3,5,7,9,16-pentazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2,5,7,10,12,14-heptaene |
| SMILES | c1ccc(-c2nc3nonc3c3nc4ccccc4n23)cc1 |
| InChI | InChI=1S/C16H9N5O/c1-2-6-10(7-3-1)15-18-14-13(19-22-20-14)16-17-11-8-4-5-9-12(11)21(15)16/h1-9H |
| InChIKey | UQVFPELVKBDQIB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |