About 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine
5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 65035545) has the molecular formula C8H16N2S2
and a molecular weight of 204.36 g/mol. Its IUPAC name is 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 65035545 |
| Molecular Formula | C8H16N2S2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CSCCNC1=NCC(C)CS1 |
| InChI | InChI=1S/C8H16N2S2/c1-7-5-10-8(12-6-7)9-3-4-11-2/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | MTBBQFLMRDYKAB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 65035545) is 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is CSCCNC1=NCC(C)CS1.
What is the InChIKey of 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is MTBBQFLMRDYKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S2/c1-7-5-10-8(12-6-7)9-3-4-11-2/h7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 204.36 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(2-methylsulfanylethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 65035545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).