About 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane
2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane (PubChem CID 65035548) has the molecular formula C14H21NO3
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane |
| PubChem CID | 65035548 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane |
| SMILES | COc1ccc(C2CNCC(C)CO2)cc1OC |
| InChI | InChI=1S/C14H21NO3/c1-10-7-15-8-14(18-9-10)11-4-5-12(16-2)13(6-11)17-3/h4-6,10,14-15H,7-9H2,1-3H3 |
| InChIKey | JOULQLPHHPIFEP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane (CID 65035548) is 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane is COc1ccc(C2CNCC(C)CO2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane?
The InChIKey is JOULQLPHHPIFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-10-7-15-8-14(18-9-10)11-4-5-12(16-2)13(6-11)17-3/h4-6,10,14-15H,7-9H2,1-3H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane?
2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane has a molecular weight of 251.33 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-6-methyl-1,4-oxazepane is sourced from PubChem (CID 65035548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).