About 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile
1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile (PubChem CID 65035685) has the molecular formula C11H8F3N3
and a molecular weight of 239.20 g/mol. Its IUPAC name is 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile.
Molecular Properties
| Compound Name | 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile |
| PubChem CID | 65035685 |
| Molecular Formula | C11H8F3N3 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile |
| SMILES | Cn1c(CC(F)(F)F)nc2cc(C#N)ccc21 |
| InChI | InChI=1S/C11H8F3N3/c1-17-9-3-2-7(6-15)4-8(9)16-10(17)5-11(12,13)14/h2-4H,5H2,1H3 |
| InChIKey | PSGKGWADTBCYCY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile?
The IUPAC name of 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile (CID 65035685) is 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile.
What is the SMILES notation for 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile?
The canonical SMILES for 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile is Cn1c(CC(F)(F)F)nc2cc(C#N)ccc21.
What is the InChIKey of 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile?
The InChIKey is PSGKGWADTBCYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F3N3/c1-17-9-3-2-7(6-15)4-8(9)16-10(17)5-11(12,13)14/h2-4H,5H2,1H3.
What are the key properties of 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile?
1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile has a molecular weight of 239.20 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(2,2,2-trifluoroethyl)benzimidazole-5-carbonitrile is sourced from PubChem (CID 65035685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).