C11H22N2O2 — CID 65036083
1-amino-N-(3-hydroxy-2-methylpropyl)cyclohexane-1-carboxamide (PubChem CID 65036083) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-amino-N-(3-hydroxy-2-methylpropyl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-(3-hydroxy-2-methylpropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 65036083 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-amino-N-(3-hydroxy-2-methylpropyl)cyclohexane-1-carboxamide |
| SMILES | CC(CO)CNC(=O)C1(N)CCCCC1 |
| InChI | InChI=1S/C11H22N2O2/c1-9(8-14)7-13-10(15)11(12)5-3-2-4-6-11/h9,14H,2-8,12H2,1H3,(H,13,15) |
| InChIKey | WFJPVIXEHZNTBN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |