C11H15BrFNO — CID 65036447
3-[(2-bromo-5-fluorophenyl)methylamino]-2-methylpropan-1-ol (PubChem CID 65036447) has the molecular formula C11H15BrFNO and a molecular weight of 276.15 g/mol. Its IUPAC name is 3-[(2-bromo-5-fluorophenyl)methylamino]-2-methylpropan-1-ol.
| Compound Name | 3-[(2-bromo-5-fluorophenyl)methylamino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 65036447 |
| Molecular Formula | C11H15BrFNO |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 3-[(2-bromo-5-fluorophenyl)methylamino]-2-methylpropan-1-ol |
| SMILES | CC(CO)CNCc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H15BrFNO/c1-8(7-15)5-14-6-9-4-10(13)2-3-11(9)12/h2-4,8,14-15H,5-7H2,1H3 |
| InChIKey | NTABPKQIPMWIAC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |