About N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide
N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 65036961) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| PubChem CID | 65036961 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | CC(CO)CNC(=O)C1=COCCO1 |
| InChI | InChI=1S/C9H15NO4/c1-7(5-11)4-10-9(12)8-6-13-2-3-14-8/h6-7,11H,2-5H2,1H3,(H,10,12) |
| InChIKey | GZIPWBDFAODTJW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The IUPAC name of N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (CID 65036961) is N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
What is the SMILES notation for N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The canonical SMILES for N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide is CC(CO)CNC(=O)C1=COCCO1.
What is the InChIKey of N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
The InChIKey is GZIPWBDFAODTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-7(5-11)4-10-9(12)8-6-13-2-3-14-8/h6-7,11H,2-5H2,1H3,(H,10,12).
What are the key properties of N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide?
N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide has a molecular weight of 201.22 g/mol, XLogP of -0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-2-methylpropyl)-2,3-dihydro-1,4-dioxine-5-carboxamide is sourced from PubChem (CID 65036961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).