C8H14ClN3 — CID 65037048
N-(3-chloro-2-methylpropyl)-1-methylimidazol-2-amine (PubChem CID 65037048) has the molecular formula C8H14ClN3 and a molecular weight of 187.67 g/mol. Its IUPAC name is N-(3-chloro-2-methylpropyl)-1-methylimidazol-2-amine.
| Compound Name | N-(3-chloro-2-methylpropyl)-1-methylimidazol-2-amine |
|---|---|
| PubChem CID | 65037048 |
| Molecular Formula | C8H14ClN3 |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | N-(3-chloro-2-methylpropyl)-1-methylimidazol-2-amine |
| SMILES | CC(CCl)CNc1nccn1C |
| InChI | InChI=1S/C8H14ClN3/c1-7(5-9)6-11-8-10-3-4-12(8)2/h3-4,7H,5-6H2,1-2H3,(H,10,11) |
| InChIKey | ZFHHPZIJBMMBGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|