About 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine
2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine (PubChem CID 65038550) has the molecular formula C11H17BrN2S
and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine.
Molecular Properties
| Compound Name | 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine |
| PubChem CID | 65038550 |
| Molecular Formula | C11H17BrN2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine |
| SMILES | Cc1nc(SCC(C)CBr)nc(C)c1C |
| InChI | InChI=1S/C11H17BrN2S/c1-7(5-12)6-15-11-13-9(3)8(2)10(4)14-11/h7H,5-6H2,1-4H3 |
| InChIKey | BIZAQRBPVYRFTF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine?
The IUPAC name of 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine (CID 65038550) is 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine.
What is the SMILES notation for 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine?
The canonical SMILES for 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine is Cc1nc(SCC(C)CBr)nc(C)c1C.
What is the InChIKey of 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine?
The InChIKey is BIZAQRBPVYRFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrN2S/c1-7(5-12)6-15-11-13-9(3)8(2)10(4)14-11/h7H,5-6H2,1-4H3.
What are the key properties of 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine?
2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine has a molecular weight of 289.24 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2-methylpropyl)sulfanyl-4,5,6-trimethylpyrimidine is sourced from PubChem (CID 65038550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).