About 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile
1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile (PubChem CID 65040130) has the molecular formula C16H15N5
and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile |
| PubChem CID | 65040130 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile |
| SMILES | Cc1c(-c2nc3cc(C#N)ccc3n2C2CC2)cnn1C |
| InChI | InChI=1S/C16H15N5/c1-10-13(9-18-20(10)2)16-19-14-7-11(8-17)3-6-15(14)21(16)12-4-5-12/h3,6-7,9,12H,4-5H2,1-2H3 |
| InChIKey | DEKNRBDUFYBOCX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile?
The IUPAC name of 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile (CID 65040130) is 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile.
What is the SMILES notation for 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile?
The canonical SMILES for 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile is Cc1c(-c2nc3cc(C#N)ccc3n2C2CC2)cnn1C.
What is the InChIKey of 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile?
The InChIKey is DEKNRBDUFYBOCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5/c1-10-13(9-18-20(10)2)16-19-14-7-11(8-17)3-6-15(14)21(16)12-4-5-12/h3,6-7,9,12H,4-5H2,1-2H3.
What are the key properties of 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile?
1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile has a molecular weight of 277.33 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(1,5-dimethylpyrazol-4-yl)benzimidazole-5-carbonitrile is sourced from PubChem (CID 65040130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).