About methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate
methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate (PubChem CID 65040826) has the molecular formula C13H21N3O2S
and a molecular weight of 283.40 g/mol. Its IUPAC name is methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate.
Molecular Properties
| Compound Name | methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate |
| PubChem CID | 65040826 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate |
| SMILES | CCNC(CSc1nc(C)c(C)c(C)n1)C(=O)OC |
| InChI | InChI=1S/C13H21N3O2S/c1-6-14-11(12(17)18-5)7-19-13-15-9(3)8(2)10(4)16-13/h11,14H,6-7H2,1-5H3 |
| InChIKey | NLLFSPFTLWJAJL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate?
The IUPAC name of methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate (CID 65040826) is methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate.
What is the SMILES notation for methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate?
The canonical SMILES for methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate is CCNC(CSc1nc(C)c(C)c(C)n1)C(=O)OC.
What is the InChIKey of methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate?
The InChIKey is NLLFSPFTLWJAJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2S/c1-6-14-11(12(17)18-5)7-19-13-15-9(3)8(2)10(4)16-13/h11,14H,6-7H2,1-5H3.
What are the key properties of methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate?
methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate has a molecular weight of 283.40 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(ethylamino)-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanoate is sourced from PubChem (CID 65040826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).