About 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine
1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine (PubChem CID 65040999) has the molecular formula C16H20ClN3S
and a molecular weight of 321.88 g/mol. Its IUPAC name is 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine |
| PubChem CID | 65040999 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine |
| SMILES | Cc1nc(Sc2cccc(Cl)c2CC(C)N)nc(C)c1C |
| InChI | InChI=1S/C16H20ClN3S/c1-9(18)8-13-14(17)6-5-7-15(13)21-16-19-11(3)10(2)12(4)20-16/h5-7,9H,8,18H2,1-4H3 |
| InChIKey | FBIZNTXLMMVOAP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine?
The IUPAC name of 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine (CID 65040999) is 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine.
What is the SMILES notation for 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine?
The canonical SMILES for 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine is Cc1nc(Sc2cccc(Cl)c2CC(C)N)nc(C)c1C.
What is the InChIKey of 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine?
The InChIKey is FBIZNTXLMMVOAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3S/c1-9(18)8-13-14(17)6-5-7-15(13)21-16-19-11(3)10(2)12(4)20-16/h5-7,9H,8,18H2,1-4H3.
What are the key properties of 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine?
1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine has a molecular weight of 321.88 g/mol, XLogP of 4.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-chloro-6-(4,5,6-trimethylpyrimidin-2-yl)sulfanylphenyl]propan-2-amine is sourced from PubChem (CID 65040999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).