C15H27N3S — CID 65041030
3,3-dimethyl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]butan-1-amine (PubChem CID 65041030) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]butan-1-amine.
| Compound Name | 3,3-dimethyl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]butan-1-amine |
|---|---|
| PubChem CID | 65041030 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3,3-dimethyl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]butan-1-amine |
| SMILES | Cc1nc(SCCNCCC(C)(C)C)nc(C)c1C |
| InChI | InChI=1S/C15H27N3S/c1-11-12(2)17-14(18-13(11)3)19-10-9-16-8-7-15(4,5)6/h16H,7-10H2,1-6H3 |
| InChIKey | IQUDVIPYZOOTOE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|