C14H15N3O — CID 65041776
pyrimidin-4-yl(1,2,3,4-tetrahydroquinolin-2-yl)methanol (PubChem CID 65041776) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is pyrimidin-4-yl(1,2,3,4-tetrahydroquinolin-2-yl)methanol.
| Compound Name | pyrimidin-4-yl(1,2,3,4-tetrahydroquinolin-2-yl)methanol |
|---|---|
| PubChem CID | 65041776 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | pyrimidin-4-yl(1,2,3,4-tetrahydroquinolin-2-yl)methanol |
| SMILES | OC(c1ccncn1)C1CCc2ccccc2N1 |
| InChI | InChI=1S/C14H15N3O/c18-14(12-7-8-15-9-16-12)13-6-5-10-3-1-2-4-11(10)17-13/h1-4,7-9,13-14,17-18H,5-6H2 |
| InChIKey | PNOJWXOEIJPUPP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |