About 2-pyrazin-2-yl-2,3-dihydro-1H-indole
2-pyrazin-2-yl-2,3-dihydro-1H-indole (PubChem CID 65042123) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-pyrazin-2-yl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 2-pyrazin-2-yl-2,3-dihydro-1H-indole |
| PubChem CID | 65042123 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-pyrazin-2-yl-2,3-dihydro-1H-indole |
| SMILES | c1ccc2c(c1)CC(c1cnccn1)N2 |
| InChI | InChI=1S/C12H11N3/c1-2-4-10-9(3-1)7-11(15-10)12-8-13-5-6-14-12/h1-6,8,11,15H,7H2 |
| InChIKey | UUUSVZONQWHPBY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrazin-2-yl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazin-2-yl-2,3-dihydro-1H-indole?
The IUPAC name of 2-pyrazin-2-yl-2,3-dihydro-1H-indole (CID 65042123) is 2-pyrazin-2-yl-2,3-dihydro-1H-indole.
What is the SMILES notation for 2-pyrazin-2-yl-2,3-dihydro-1H-indole?
The canonical SMILES for 2-pyrazin-2-yl-2,3-dihydro-1H-indole is c1ccc2c(c1)CC(c1cnccn1)N2.
What is the InChIKey of 2-pyrazin-2-yl-2,3-dihydro-1H-indole?
The InChIKey is UUUSVZONQWHPBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-2-4-10-9(3-1)7-11(15-10)12-8-13-5-6-14-12/h1-6,8,11,15H,7H2.
What are the key properties of 2-pyrazin-2-yl-2,3-dihydro-1H-indole?
2-pyrazin-2-yl-2,3-dihydro-1H-indole has a molecular weight of 197.24 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazin-2-yl-2,3-dihydro-1H-indole is sourced from PubChem (CID 65042123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).