About 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole
1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole (PubChem CID 65042203) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole |
| PubChem CID | 65042203 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole |
| SMILES | CCOc1ccc(C2NCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H17NO/c1-2-18-14-9-7-12(8-10-14)16-15-6-4-3-5-13(15)11-17-16/h3-10,16-17H,2,11H2,1H3 |
| InChIKey | PCSTVJUMZUVLES-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole?
The IUPAC name of 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole (CID 65042203) is 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole?
The canonical SMILES for 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole is CCOc1ccc(C2NCc3ccccc32)cc1.
What is the InChIKey of 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole?
The InChIKey is PCSTVJUMZUVLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-2-18-14-9-7-12(8-10-14)16-15-6-4-3-5-13(15)11-17-16/h3-10,16-17H,2,11H2,1H3.
What are the key properties of 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole?
1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole has a molecular weight of 239.32 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethoxyphenyl)-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 65042203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).