About N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine
N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine (PubChem CID 65043268) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine.
Molecular Properties
| Compound Name | N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine |
| PubChem CID | 65043268 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine |
| SMILES | CNCCCSc1nc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C11H19N3S/c1-8-9(2)13-11(14-10(8)3)15-7-5-6-12-4/h12H,5-7H2,1-4H3 |
| InChIKey | CCJNLXIUUIVQDB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine?
The IUPAC name of N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine (CID 65043268) is N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine.
What is the SMILES notation for N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine?
The canonical SMILES for N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine is CNCCCSc1nc(C)c(C)c(C)n1.
What is the InChIKey of N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine?
The InChIKey is CCJNLXIUUIVQDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S/c1-8-9(2)13-11(14-10(8)3)15-7-5-6-12-4/h12H,5-7H2,1-4H3.
What are the key properties of N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine?
N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine has a molecular weight of 225.36 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropan-1-amine is sourced from PubChem (CID 65043268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).