About 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine
2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine (PubChem CID 65043365) has the molecular formula C9H13N5S
and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine.
Molecular Properties
| Compound Name | 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine |
| PubChem CID | 65043365 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine |
| SMILES | Cc1nc(SCCN=[N+]=[N-])nc(C)c1C |
| InChI | InChI=1S/C9H13N5S/c1-6-7(2)12-9(13-8(6)3)15-5-4-11-14-10/h4-5H2,1-3H3 |
| InChIKey | TWKQUDUSRABIGK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine?
The IUPAC name of 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine (CID 65043365) is 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine.
What is the SMILES notation for 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine?
The canonical SMILES for 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine is Cc1nc(SCCN=[N+]=[N-])nc(C)c1C.
What is the InChIKey of 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine?
The InChIKey is TWKQUDUSRABIGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5S/c1-6-7(2)12-9(13-8(6)3)15-5-4-11-14-10/h4-5H2,1-3H3.
What are the key properties of 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine?
2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine has a molecular weight of 223.30 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-azidoethylsulfanyl)-4,5,6-trimethylpyrimidine is sourced from PubChem (CID 65043365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).