About 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide
2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 650434) has the molecular formula C17H18N4O2S
and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 650434 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2csc(NC(=O)Cn3nc(C)cc3C)n2)cc1 |
| InChI | InChI=1S/C17H18N4O2S/c1-11-8-12(2)21(20-11)9-16(22)19-17-18-15(10-24-17)13-4-6-14(23-3)7-5-13/h4-8,10H,9H2,1-3H3,(H,18,19,22) |
| InChIKey | YPWQUBCETUTRSX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (CID 650434) is 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide is COc1ccc(-c2csc(NC(=O)Cn3nc(C)cc3C)n2)cc1.
What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is YPWQUBCETUTRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2S/c1-11-8-12(2)21(20-11)9-16(22)19-17-18-15(10-24-17)13-4-6-14(23-3)7-5-13/h4-8,10H,9H2,1-3H3,(H,18,19,22).
What are the key properties of 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide?
2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 342.42 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpyrazol-1-yl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 650434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).