C11H19NO5S — CID 65045086
1-[acetyl(ethyl)amino]-2-methylsulfonylcyclopentane-1-carboxylic acid (PubChem CID 65045086) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-[acetyl(ethyl)amino]-2-methylsulfonylcyclopentane-1-carboxylic acid.
| Compound Name | 1-[acetyl(ethyl)amino]-2-methylsulfonylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 65045086 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[acetyl(ethyl)amino]-2-methylsulfonylcyclopentane-1-carboxylic acid |
| SMILES | CCN(C(C)=O)C1(C(=O)O)CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C11H19NO5S/c1-4-12(8(2)13)11(10(14)15)7-5-6-9(11)18(3,16)17/h9H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | IURZJKXEEDFVLS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |