C9H16N2O2S — CID 65045168
1-(ethylamino)-2-methylsulfonylcyclopentane-1-carbonitrile (PubChem CID 65045168) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 1-(ethylamino)-2-methylsulfonylcyclopentane-1-carbonitrile.
| Compound Name | 1-(ethylamino)-2-methylsulfonylcyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 65045168 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(ethylamino)-2-methylsulfonylcyclopentane-1-carbonitrile |
| SMILES | CCNC1(C#N)CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C9H16N2O2S/c1-3-11-9(7-10)6-4-5-8(9)14(2,12)13/h8,11H,3-6H2,1-2H3 |
| InChIKey | KJFVCHRZLYJXQD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |