C10H12O2 — CID 6504517
(2E,4E,6E)-2,7-dimethylocta-2,4,6-trienedial (PubChem CID 6504517) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (2E,4E,6E)-2,7-dimethylocta-2,4,6-trienedial.
| Compound Name | (2E,4E,6E)-2,7-dimethylocta-2,4,6-trienedial |
|---|---|
| PubChem CID | 6504517 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (2E,4E,6E)-2,7-dimethylocta-2,4,6-trienedial |
| SMILES | C/C(C=O)=C\C=C\C=C(/C)C=O |
| InChI | InChI=1S/C10H12O2/c1-9(7-11)5-3-4-6-10(2)8-12/h3-8H,1-2H3/b4-3+,9-5+,10-6+ |
| InChIKey | AYODHZHFDRRQEZ-XLKYRCCQSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|