C10H19NO2 — CID 65045182
ethyl 2-methyl-1-(methylamino)cyclopentane-1-carboxylate (PubChem CID 65045182) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is ethyl 2-methyl-1-(methylamino)cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-methyl-1-(methylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 65045182 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | ethyl 2-methyl-1-(methylamino)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC)CCCC1C |
| InChI | InChI=1S/C10H19NO2/c1-4-13-9(12)10(11-3)7-5-6-8(10)2/h8,11H,4-7H2,1-3H3 |
| InChIKey | RXBRRAPMGHWREA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |