C21H20N4O5S2 — CID 650456
N-[3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]phenyl]pyridine-2-carboxamide (PubChem CID 650456) has the molecular formula C21H20N4O5S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 650456 |
| Molecular Formula | C21H20N4O5S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | N-[3-[[4-(cyclopropylsulfamoyl)phenyl]sulfonylamino]phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc(NS(=O)(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)c1)c1ccccn1 |
| InChI | InChI=1S/C21H20N4O5S2/c26-21(20-6-1-2-13-22-20)23-16-4-3-5-17(14-16)25-32(29,30)19-11-9-18(10-12-19)31(27,28)24-15-7-8-15/h1-6,9-15,24-25H,7-8H2,(H,23,26) |
| InChIKey | FXEKYLIMEGOHLI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |