C22H31N3O2 — CID 650464
4-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)piperidine-1,4-dicarboxamide (PubChem CID 650464) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 650464 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-1-N-(4-methylphenyl)piperidine-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC(C(=O)NCCC3=CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O2/c1-17-7-9-20(10-8-17)24-22(27)25-15-12-19(13-16-25)21(26)23-14-11-18-5-3-2-4-6-18/h5,7-10,19H,2-4,6,11-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | FTMNEIDRQRUFJT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|