About 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole
1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole (PubChem CID 65047103) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole |
| PubChem CID | 65047103 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole |
| SMILES | Cc1cc(C)cc(CC2NCc3ccccc32)c1 |
| InChI | InChI=1S/C17H19N/c1-12-7-13(2)9-14(8-12)10-17-16-6-4-3-5-15(16)11-18-17/h3-9,17-18H,10-11H2,1-2H3 |
| InChIKey | RMQXMQIBOLXWCW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole?
The IUPAC name of 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole (CID 65047103) is 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole?
The canonical SMILES for 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole is Cc1cc(C)cc(CC2NCc3ccccc32)c1.
What is the InChIKey of 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole?
The InChIKey is RMQXMQIBOLXWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-12-7-13(2)9-14(8-12)10-17-16-6-4-3-5-15(16)11-18-17/h3-9,17-18H,10-11H2,1-2H3.
What are the key properties of 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole?
1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole has a molecular weight of 237.35 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethylphenyl)methyl]-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 65047103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).