C14H22FNO — CID 65047182
N-[1-(3-fluorophenyl)ethyl]-1-methoxy-3-methylbutan-2-amine (PubChem CID 65047182) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)ethyl]-1-methoxy-3-methylbutan-2-amine.
| Compound Name | N-[1-(3-fluorophenyl)ethyl]-1-methoxy-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 65047182 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-[1-(3-fluorophenyl)ethyl]-1-methoxy-3-methylbutan-2-amine |
| SMILES | COCC(NC(C)c1cccc(F)c1)C(C)C |
| InChI | InChI=1S/C14H22FNO/c1-10(2)14(9-17-4)16-11(3)12-6-5-7-13(15)8-12/h5-8,10-11,14,16H,9H2,1-4H3 |
| InChIKey | HARHGMFEVZUXNQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |