About 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid
1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid (PubChem CID 650474) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid |
| PubChem CID | 650474 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid |
| SMILES | Cc1cc(C)nc(N2CCCC(C(=O)O)C2)n1 |
| InChI | InChI=1S/C12H17N3O2/c1-8-6-9(2)14-12(13-8)15-5-3-4-10(7-15)11(16)17/h6,10H,3-5,7H2,1-2H3,(H,16,17) |
| InChIKey | YCSSRSNBRMYUKP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid (CID 650474) is 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid is Cc1cc(C)nc(N2CCCC(C(=O)O)C2)n1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid?
The InChIKey is YCSSRSNBRMYUKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-8-6-9(2)14-12(13-8)15-5-3-4-10(7-15)11(16)17/h6,10H,3-5,7H2,1-2H3,(H,16,17).
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid?
1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid has a molecular weight of 235.29 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxylic acid is sourced from PubChem (CID 650474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).