About 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene
4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene (PubChem CID 650478) has the molecular formula C16H18O6S
and a molecular weight of 338.38 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene |
| PubChem CID | 650478 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C16H18O6S/c1-19-13-7-5-11(9-15(13)21-3)23(17,18)12-6-8-14(20-2)16(10-12)22-4/h5-10H,1-4H3 |
| InChIKey | GDKBAIOAVDOQES-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene?
The IUPAC name of 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene (CID 650478) is 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene is COc1ccc(S(=O)(=O)c2ccc(OC)c(OC)c2)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene?
The InChIKey is GDKBAIOAVDOQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O6S/c1-19-13-7-5-11(9-15(13)21-3)23(17,18)12-6-8-14(20-2)16(10-12)22-4/h5-10H,1-4H3.
What are the key properties of 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene?
4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene has a molecular weight of 338.38 g/mol, XLogP of 2.55, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)sulfonyl-1,2-dimethoxybenzene is sourced from PubChem (CID 650478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).