C11H17BrN2O3S — CID 65048630
5-bromo-N-(1-methoxy-3-methylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 65048630) has the molecular formula C11H17BrN2O3S and a molecular weight of 337.24 g/mol. Its IUPAC name is 5-bromo-N-(1-methoxy-3-methylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-(1-methoxy-3-methylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 65048630 |
| Molecular Formula | C11H17BrN2O3S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 5-bromo-N-(1-methoxy-3-methylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | COCC(NS(=O)(=O)c1cncc(Br)c1)C(C)C |
| InChI | InChI=1S/C11H17BrN2O3S/c1-8(2)11(7-17-3)14-18(15,16)10-4-9(12)5-13-6-10/h4-6,8,11,14H,7H2,1-3H3 |
| InChIKey | RUEPKJYEYKTPCD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |