C13H26N2O2 — CID 65049389
2-(cyclopentylamino)-N-(1-methoxy-3-methylbutan-2-yl)acetamide (PubChem CID 65049389) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(cyclopentylamino)-N-(1-methoxy-3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(cyclopentylamino)-N-(1-methoxy-3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 65049389 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-(cyclopentylamino)-N-(1-methoxy-3-methylbutan-2-yl)acetamide |
| SMILES | COCC(NC(=O)CNC1CCCC1)C(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-10(2)12(9-17-3)15-13(16)8-14-11-6-4-5-7-11/h10-12,14H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | PBWDXQKBDOVSQV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |