C15H17NO3S — CID 65049610
1-isoquinolin-4-yl-2-methylsulfonylcyclopentan-1-ol (PubChem CID 65049610) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-isoquinolin-4-yl-2-methylsulfonylcyclopentan-1-ol.
| Compound Name | 1-isoquinolin-4-yl-2-methylsulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 65049610 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-isoquinolin-4-yl-2-methylsulfonylcyclopentan-1-ol |
| SMILES | CS(=O)(=O)C1CCCC1(O)c1cncc2ccccc12 |
| InChI | InChI=1S/C15H17NO3S/c1-20(18,19)14-7-4-8-15(14,17)13-10-16-9-11-5-2-3-6-12(11)13/h2-3,5-6,9-10,14,17H,4,7-8H2,1H3 |
| InChIKey | PWDMNCNHKAKTAX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |