About cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate
cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate (PubChem CID 650497) has the molecular formula C20H27NO5
and a molecular weight of 361.44 g/mol. Its IUPAC name is cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate.
Molecular Properties
| Compound Name | cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate |
| PubChem CID | 650497 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate |
| SMILES | O=C(CN1CCC(O)(c2ccc3c(c2)OCO3)CC1)OC1CCCCC1 |
| InChI | InChI=1S/C20H27NO5/c22-19(26-16-4-2-1-3-5-16)13-21-10-8-20(23,9-11-21)15-6-7-17-18(12-15)25-14-24-17/h6-7,12,16,23H,1-5,8-11,13-14H2 |
| InChIKey | DLHKVNXJHQYCSK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate?
The IUPAC name of cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate (CID 650497) is cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate.
What is the SMILES notation for cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate?
The canonical SMILES for cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate is O=C(CN1CCC(O)(c2ccc3c(c2)OCO3)CC1)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate?
The InChIKey is DLHKVNXJHQYCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO5/c22-19(26-16-4-2-1-3-5-16)13-21-10-8-20(23,9-11-21)15-6-7-17-18(12-15)25-14-24-17/h6-7,12,16,23H,1-5,8-11,13-14H2.
What are the key properties of cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate?
cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate has a molecular weight of 361.44 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-[4-(1,3-benzodioxol-5-yl)-4-hydroxypiperidin-1-yl]acetate is sourced from PubChem (CID 650497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).