About [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol
[2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol (PubChem CID 65049724) has the molecular formula C9H16F3NO3S
and a molecular weight of 275.29 g/mol. Its IUPAC name is [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol |
| PubChem CID | 65049724 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol |
| SMILES | CS(=O)(=O)C1CCCC1(CO)NCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3S/c1-17(15,16)7-3-2-4-8(7,6-14)13-5-9(10,11)12/h7,13-14H,2-6H2,1H3 |
| InChIKey | CIDJFHZYKDUCPI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
The IUPAC name of [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol (CID 65049724) is [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol.
What is the SMILES notation for [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
The canonical SMILES for [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol is CS(=O)(=O)C1CCCC1(CO)NCC(F)(F)F.
What is the InChIKey of [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
The InChIKey is CIDJFHZYKDUCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3S/c1-17(15,16)7-3-2-4-8(7,6-14)13-5-9(10,11)12/h7,13-14H,2-6H2,1H3.
What are the key properties of [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol?
[2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol has a molecular weight of 275.29 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methylsulfonyl-1-(2,2,2-trifluoroethylamino)cyclopentyl]methanol is sourced from PubChem (CID 65049724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).