About 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one
1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one (PubChem CID 65051176) has the molecular formula C14H27N3O2
and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one |
| PubChem CID | 65051176 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one |
| SMILES | CC1(C)CCC(CN)(OCCN2CCNC2=O)CC1 |
| InChI | InChI=1S/C14H27N3O2/c1-13(2)3-5-14(11-15,6-4-13)19-10-9-17-8-7-16-12(17)18/h3-11,15H2,1-2H3,(H,16,18) |
| InChIKey | UHGULLSADPAKQA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one?
The IUPAC name of 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one (CID 65051176) is 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one is CC1(C)CCC(CN)(OCCN2CCNC2=O)CC1.
What is the InChIKey of 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one?
The InChIKey is UHGULLSADPAKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O2/c1-13(2)3-5-14(11-15,6-4-13)19-10-9-17-8-7-16-12(17)18/h3-11,15H2,1-2H3,(H,16,18).
What are the key properties of 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one?
1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one has a molecular weight of 269.39 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyethyl]imidazolidin-2-one is sourced from PubChem (CID 65051176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).