About [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine
[1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine (PubChem CID 65051906) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine.
Molecular Properties
| Compound Name | [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine |
| PubChem CID | 65051906 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine |
| SMILES | NCC1(OCCC(F)(F)F)CCCCCC1 |
| InChI | InChI=1S/C11H20F3NO/c12-11(13,14)7-8-16-10(9-15)5-3-1-2-4-6-10/h1-9,15H2 |
| InChIKey | QSMBTJVNVHBDHR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine?
The IUPAC name of [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine (CID 65051906) is [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine.
What is the SMILES notation for [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine?
The canonical SMILES for [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine is NCC1(OCCC(F)(F)F)CCCCCC1.
What is the InChIKey of [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine?
The InChIKey is QSMBTJVNVHBDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c12-11(13,14)7-8-16-10(9-15)5-3-1-2-4-6-10/h1-9,15H2.
What are the key properties of [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine?
[1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine has a molecular weight of 239.28 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,3,3-trifluoropropoxy)cycloheptyl]methanamine is sourced from PubChem (CID 65051906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).