C10H15NO2S — CID 65053438
2-amino-3,6-diethoxybenzenethiol (PubChem CID 65053438) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 2-amino-3,6-diethoxybenzenethiol.
| Compound Name | 2-amino-3,6-diethoxybenzenethiol |
|---|---|
| PubChem CID | 65053438 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-amino-3,6-diethoxybenzenethiol |
| SMILES | CCOc1ccc(OCC)c(S)c1N |
| InChI | InChI=1S/C10H15NO2S/c1-3-12-7-5-6-8(13-4-2)10(14)9(7)11/h5-6,14H,3-4,11H2,1-2H3 |
| InChIKey | KGPBXBQULBJQIT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|