About 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid
3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid (PubChem CID 65053853) has the molecular formula C12H22N2O4S
and a molecular weight of 290.38 g/mol. Its IUPAC name is 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid |
| PubChem CID | 65053853 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C12H22N2O4S/c15-12(16)1-4-13-5-7-14(8-6-13)11-2-9-19(17,18)10-3-11/h11H,1-10H2,(H,15,16) |
| InChIKey | FQSVKRUOKMLTLX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid?
The IUPAC name of 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid (CID 65053853) is 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid?
The canonical SMILES for 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid is O=C(O)CCN1CCN(C2CCS(=O)(=O)CC2)CC1.
What is the InChIKey of 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid?
The InChIKey is FQSVKRUOKMLTLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4S/c15-12(16)1-4-13-5-7-14(8-6-13)11-2-9-19(17,18)10-3-11/h11H,1-10H2,(H,15,16).
What are the key properties of 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid?
3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid has a molecular weight of 290.38 g/mol, XLogP of -0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,1-dioxothian-4-yl)piperazin-1-yl]propanoic acid is sourced from PubChem (CID 65053853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).