C13H20F3NO2 — CID 65054518
2-[cyclopropylmethyl-[3-(trifluoromethyl)cyclohexyl]amino]acetic acid (PubChem CID 65054518) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-(trifluoromethyl)cyclohexyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-(trifluoromethyl)cyclohexyl]amino]acetic acid |
|---|---|
| PubChem CID | 65054518 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-(trifluoromethyl)cyclohexyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H20F3NO2/c14-13(15,16)10-2-1-3-11(6-10)17(8-12(18)19)7-9-4-5-9/h9-11H,1-8H2,(H,18,19) |
| InChIKey | RTFZEVZHDYLBCG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |