C12H20N2O2S — CID 65054987
2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid (PubChem CID 65054987) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid.
| Compound Name | 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 65054987 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid |
| SMILES | CCCC(NC(C)c1sc(C)nc1C)C(=O)O |
| InChI | InChI=1S/C12H20N2O2S/c1-5-6-10(12(15)16)14-8(3)11-7(2)13-9(4)17-11/h8,10,14H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | ITQXDZKGBLLCDH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |