2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid

C12H20N2O2S — CID 65054987

IUPAC2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid
SMILESCCCC(NC(C)c1sc(C)nc1C)C(=O)O
InChIInChI=1S/C12H20N2O2S/c1-5-6-10(12(15)16)14-8(3)11-7(2)13-9(4)17-11/h8,10,14H,5-6H2,1-4H3,(H,15,16)
InChIKeyITQXDZKGBLLCDH-UHFFFAOYSA-N
MW256.37 g/mol
LogP2.66
Rot. Bonds6

About 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid

2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid (PubChem CID 65054987) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid.

Molecular Properties

Compound Name2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid
PubChem CID65054987
Molecular FormulaC12H20N2O2S
Molecular Weight256.37 g/mol
Exact Mass256.12
IUPAC Name2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid
SMILESCCCC(NC(C)c1sc(C)nc1C)C(=O)O
InChIInChI=1S/C12H20N2O2S/c1-5-6-10(12(15)16)14-8(3)11-7(2)13-9(4)17-11/h8,10,14H,5-6H2,1-4H3,(H,15,16)
InChIKeyITQXDZKGBLLCDH-UHFFFAOYSA-N
XLogP2.66
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.37
LogP ≤ 52.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
The IUPAC name of 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid (CID 65054987) is 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid.
What is the SMILES notation for 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
The canonical SMILES for 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid is CCCC(NC(C)c1sc(C)nc1C)C(=O)O.
What is the InChIKey of 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
The InChIKey is ITQXDZKGBLLCDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S/c1-5-6-10(12(15)16)14-8(3)11-7(2)13-9(4)17-11/h8,10,14H,5-6H2,1-4H3,(H,15,16).
What are the key properties of 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid has a molecular weight of 256.37 g/mol, XLogP of 2.66, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid is sourced from PubChem (CID 65054987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).