C11H14FNO2 — CID 65056319
2-[(4-fluoro-2-methylphenyl)methyl-methylamino]acetic acid (PubChem CID 65056319) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-[(4-fluoro-2-methylphenyl)methyl-methylamino]acetic acid.
| Compound Name | 2-[(4-fluoro-2-methylphenyl)methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 65056319 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-[(4-fluoro-2-methylphenyl)methyl-methylamino]acetic acid |
| SMILES | Cc1cc(F)ccc1CN(C)CC(=O)O |
| InChI | InChI=1S/C11H14FNO2/c1-8-5-10(12)4-3-9(8)6-13(2)7-11(14)15/h3-5H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | VRYCUMFOQHVDOO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |