C10H13NO3 — CID 65056465
2-[(4-hydroxyphenyl)methyl-methylamino]acetic acid (PubChem CID 65056465) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-[(4-hydroxyphenyl)methyl-methylamino]acetic acid.
| Compound Name | 2-[(4-hydroxyphenyl)methyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 65056465 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-[(4-hydroxyphenyl)methyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C10H13NO3/c1-11(7-10(13)14)6-8-2-4-9(12)5-3-8/h2-5,12H,6-7H2,1H3,(H,13,14) |
| InChIKey | PZZFLKILJGILHL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |