C17H19NO3 — CID 65056725
2-[N-[1-(2-hydroxyphenyl)propyl]anilino]acetic acid (PubChem CID 65056725) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[N-[1-(2-hydroxyphenyl)propyl]anilino]acetic acid.
| Compound Name | 2-[N-[1-(2-hydroxyphenyl)propyl]anilino]acetic acid |
|---|---|
| PubChem CID | 65056725 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[N-[1-(2-hydroxyphenyl)propyl]anilino]acetic acid |
| SMILES | CCC(c1ccccc1O)N(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-2-15(14-10-6-7-11-16(14)19)18(12-17(20)21)13-8-4-3-5-9-13/h3-11,15,19H,2,12H2,1H3,(H,20,21) |
| InChIKey | LSYSHQWJRNEJIS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|