C17H33NO2 — CID 65057438
2-[butan-2-yl-[4-(2-methylbutan-2-yl)cyclohexyl]amino]acetic acid (PubChem CID 65057438) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-[butan-2-yl-[4-(2-methylbutan-2-yl)cyclohexyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[4-(2-methylbutan-2-yl)cyclohexyl]amino]acetic acid |
|---|---|
| PubChem CID | 65057438 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 2-[butan-2-yl-[4-(2-methylbutan-2-yl)cyclohexyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C1CCC(C(C)(C)CC)CC1 |
| InChI | InChI=1S/C17H33NO2/c1-6-13(3)18(12-16(19)20)15-10-8-14(9-11-15)17(4,5)7-2/h13-15H,6-12H2,1-5H3,(H,19,20) |
| InChIKey | KQLHDCMEHORTDX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |