2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid

C12H14N2O2S — CID 650588

IUPAC2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid
SMILESCc1cc2nc(SC(C)C(=O)O)[nH]c2cc1C
InChIInChI=1S/C12H14N2O2S/c1-6-4-9-10(5-7(6)2)14-12(13-9)17-8(3)11(15)16/h4-5,8H,1-3H3,(H,13,14)(H,15,16)
InChIKeyGFGCQEDWLTXSCR-UHFFFAOYSA-N
MW250.32 g/mol
LogP2.74
Rot. Bonds3

About 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid

2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid (PubChem CID 650588) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid.

Molecular Properties

Compound Name2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid
PubChem CID650588
Molecular FormulaC12H14N2O2S
Molecular Weight250.32 g/mol
Exact Mass250.08
IUPAC Name2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid
SMILESCc1cc2nc(SC(C)C(=O)O)[nH]c2cc1C
InChIInChI=1S/C12H14N2O2S/c1-6-4-9-10(5-7(6)2)14-12(13-9)17-8(3)11(15)16/h4-5,8H,1-3H3,(H,13,14)(H,15,16)
InChIKeyGFGCQEDWLTXSCR-UHFFFAOYSA-N
XLogP2.74
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.32
LogP ≤ 52.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid?
The IUPAC name of 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid (CID 650588) is 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid.
What is the SMILES notation for 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid?
The canonical SMILES for 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid is Cc1cc2nc(SC(C)C(=O)O)[nH]c2cc1C.
What is the InChIKey of 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid?
The InChIKey is GFGCQEDWLTXSCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S/c1-6-4-9-10(5-7(6)2)14-12(13-9)17-8(3)11(15)16/h4-5,8H,1-3H3,(H,13,14)(H,15,16).
What are the key properties of 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid?
2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid has a molecular weight of 250.32 g/mol, XLogP of 2.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]propanoic acid is sourced from PubChem (CID 650588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).