C18H27NO2 — CID 65059613
3-(N-(4,4-dimethylcyclohexyl)-2-methylanilino)propanoic acid (PubChem CID 65059613) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-(N-(4,4-dimethylcyclohexyl)-2-methylanilino)propanoic acid.
| Compound Name | 3-(N-(4,4-dimethylcyclohexyl)-2-methylanilino)propanoic acid |
|---|---|
| PubChem CID | 65059613 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-(N-(4,4-dimethylcyclohexyl)-2-methylanilino)propanoic acid |
| SMILES | Cc1ccccc1N(CCC(=O)O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-14-6-4-5-7-16(14)19(13-10-17(20)21)15-8-11-18(2,3)12-9-15/h4-7,15H,8-13H2,1-3H3,(H,20,21) |
| InChIKey | WIWPWHFPPZLRKU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |