C24H33N7O2 — CID 650600
3-[(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one (PubChem CID 650600) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 3-[(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 650600 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 3-[(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
| SMILES | CCOc1ccc2[nH]c(=O)c(C(c3nnnn3C3CCCCC3)N3CCN(C)CC3)cc2c1 |
| InChI | InChI=1S/C24H33N7O2/c1-3-33-19-9-10-21-17(15-19)16-20(24(32)25-21)22(30-13-11-29(2)12-14-30)23-26-27-28-31(23)18-7-5-4-6-8-18/h9-10,15-16,18,22H,3-8,11-14H2,1-2H3,(H,25,32) |
| InChIKey | RMVAFOBUZYIDQF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |