C15H21F2NO3 — CID 65060709
3-[1-[3-(difluoromethoxy)phenyl]ethyl-ethylamino]butanoic acid (PubChem CID 65060709) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is 3-[1-[3-(difluoromethoxy)phenyl]ethyl-ethylamino]butanoic acid.
| Compound Name | 3-[1-[3-(difluoromethoxy)phenyl]ethyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 65060709 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-[1-[3-(difluoromethoxy)phenyl]ethyl-ethylamino]butanoic acid |
| SMILES | CCN(C(C)CC(=O)O)C(C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H21F2NO3/c1-4-18(10(2)8-14(19)20)11(3)12-6-5-7-13(9-12)21-15(16)17/h5-7,9-11,15H,4,8H2,1-3H3,(H,19,20) |
| InChIKey | FSMCYXQKAHPIQQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |