About 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid
2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid (PubChem CID 65061531) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid.
Analyze 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
The IUPAC name of 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid (CID 65061531) is 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
The canonical SMILES for 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid is CCN(CC(C)(C)C)C(C)(C)C(=O)O.
What is the InChIKey of 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
The InChIKey is CWWAUNLEGPOGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-7-12(8-10(2,3)4)11(5,6)9(13)14/h7-8H2,1-6H3,(H,13,14).
What are the key properties of 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid has a molecular weight of 201.31 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid is sourced from PubChem (CID 65061531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).