C16H23NO4 — CID 65062883
3-[1-[1-(2,5-dihydroxyphenyl)ethyl]piperidin-4-yl]propanoic acid (PubChem CID 65062883) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[1-[1-(2,5-dihydroxyphenyl)ethyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[1-(2,5-dihydroxyphenyl)ethyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 65062883 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[1-[1-(2,5-dihydroxyphenyl)ethyl]piperidin-4-yl]propanoic acid |
| SMILES | CC(c1cc(O)ccc1O)N1CCC(CCC(=O)O)CC1 |
| InChI | InChI=1S/C16H23NO4/c1-11(14-10-13(18)3-4-15(14)19)17-8-6-12(7-9-17)2-5-16(20)21/h3-4,10-12,18-19H,2,5-9H2,1H3,(H,20,21) |
| InChIKey | DTSATROSKQHRJJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|